C12H20O2 — CID 165474318
(2E)-1-(2,2-dimethylcyclopropyl)-2-(ethoxymethylidene)butan-1-one (PubChem CID 165474318) has the molecular formula C12H20O2 and a molecular weight of 196.29 g/mol. Its IUPAC name is (2E)-1-(2,2-dimethylcyclopropyl)-2-(ethoxymethylidene)butan-1-one.
| Compound Name | (2E)-1-(2,2-dimethylcyclopropyl)-2-(ethoxymethylidene)butan-1-one |
|---|---|
| PubChem CID | 165474318 |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.15 |
| IUPAC Name | (2E)-1-(2,2-dimethylcyclopropyl)-2-(ethoxymethylidene)butan-1-one |
| SMILES | CCO/C=C(\CC)C(=O)C1CC1(C)C |
| InChI | InChI=1S/C12H20O2/c1-5-9(8-14-6-2)11(13)10-7-12(10,3)4/h8,10H,5-7H2,1-4H3/b9-8+ |
| InChIKey | RPTRXUGSRHRGTL-CMDGGOBGSA-N |
| XLogP | 2.93 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|