C12H17NO3 — CID 154464072
[(E)-2-cyano-2-propoxyethenyl] 2,2-dimethylcyclopropane-1-carboxylate (PubChem CID 154464072) has the molecular formula C12H17NO3 and a molecular weight of 223.27 g/mol. Its IUPAC name is [(E)-2-cyano-2-propoxyethenyl] 2,2-dimethylcyclopropane-1-carboxylate.
| Compound Name | [(E)-2-cyano-2-propoxyethenyl] 2,2-dimethylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 154464072 |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | [(E)-2-cyano-2-propoxyethenyl] 2,2-dimethylcyclopropane-1-carboxylate |
| SMILES | CCCO/C(C#N)=C/OC(=O)C1CC1(C)C |
| InChI | InChI=1S/C12H17NO3/c1-4-5-15-9(7-13)8-16-11(14)10-6-12(10,2)3/h8,10H,4-6H2,1-3H3/b9-8+ |
| InChIKey | PXEWZIUPOPJGDZ-CMDGGOBGSA-N |
| XLogP | 2.37 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|