C16H20Cl2F4O4 — CID 159707575
(2,4-dichloro-3,3,4,4-tetrafluorobut-1-enyl) 2,2-dimethylcyclopropane-1-carboxylate;1,2-dimethylcyclopropane-1-carboxylic acid (PubChem CID 159707575) has the molecular formula C16H20Cl2F4O4 and a molecular weight of 423.23 g/mol. Its IUPAC name is (2,4-dichloro-3,3,4,4-tetrafluorobut-1-enyl) 2,2-dimethylcyclopropane-1-carboxylate;1,2-dimethylcyclopropane-1-carboxylic acid.
| Compound Name | (2,4-dichloro-3,3,4,4-tetrafluorobut-1-enyl) 2,2-dimethylcyclopropane-1-carboxylate;1,2-dimethylcyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 159707575 |
| Molecular Formula | C16H20Cl2F4O4 |
| Molecular Weight | 423.23 g/mol |
| Exact Mass | 422.07 |
| IUPAC Name | (2,4-dichloro-3,3,4,4-tetrafluorobut-1-enyl) 2,2-dimethylcyclopropane-1-carboxylate;1,2-dimethylcyclopropane-1-carboxylic acid |
| SMILES | CC1(C)CC1C(=O)OC=C(Cl)C(F)(F)C(F)(F)Cl.CC1CC1(C)C(=O)O |
| InChI | InChI=1S/C10H10Cl2F4O2.C6H10O2/c1-8(2)3-5(8)7(17)18-4-6(11)9(13,14)10(12,15)16;1-4-3-6(4,2)5(7)8/h4-5H,3H2,1-2H3;4H,3H2,1-2H3,(H,7,8) |
| InChIKey | MYKLWRLHWGBHBD-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.23 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|