(1R)-1,2-dimethylcyclopropane-1-carboxylic acid

C6H10O2 — CID 69400955

IUPAC(1R)-1,2-dimethylcyclopropane-1-carboxylic acid
SMILESCC1C[C@@]1(C)C(=O)O
InChIInChI=1S/C6H10O2/c1-4-3-6(4,2)5(7)8/h4H,3H2,1-2H3,(H,7,8)/t4?,6-/m1/s1
InChIKeyMMEAVAVRZYNYFB-BAFYGKSASA-N
MW114.14 g/mol
LogP1.12
Rot. Bonds1

About (1R)-1,2-dimethylcyclopropane-1-carboxylic acid

(1R)-1,2-dimethylcyclopropane-1-carboxylic acid (PubChem CID 69400955) has the molecular formula C6H10O2 and a molecular weight of 114.14 g/mol. Its IUPAC name is (1R)-1,2-dimethylcyclopropane-1-carboxylic acid.

Molecular Properties

Compound Name(1R)-1,2-dimethylcyclopropane-1-carboxylic acid
PubChem CID69400955
Molecular FormulaC6H10O2
Molecular Weight114.14 g/mol
Exact Mass114.07
IUPAC Name(1R)-1,2-dimethylcyclopropane-1-carboxylic acid
SMILESCC1C[C@@]1(C)C(=O)O
InChIInChI=1S/C6H10O2/c1-4-3-6(4,2)5(7)8/h4H,3H2,1-2H3,(H,7,8)/t4?,6-/m1/s1
InChIKeyMMEAVAVRZYNYFB-BAFYGKSASA-N
XLogP1.12
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds1
Heavy Atoms8
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500114.14
LogP ≤ 51.12
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze (1R)-1,2-dimethylcyclopropane-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (1R)-1,2-dimethylcyclopropane-1-carboxylic acid?
The IUPAC name of (1R)-1,2-dimethylcyclopropane-1-carboxylic acid (CID 69400955) is (1R)-1,2-dimethylcyclopropane-1-carboxylic acid.
What is the SMILES notation for (1R)-1,2-dimethylcyclopropane-1-carboxylic acid?
The canonical SMILES for (1R)-1,2-dimethylcyclopropane-1-carboxylic acid is CC1C[C@@]1(C)C(=O)O.
What is the InChIKey of (1R)-1,2-dimethylcyclopropane-1-carboxylic acid?
The InChIKey is MMEAVAVRZYNYFB-BAFYGKSASA-N. The full InChI is InChI=1S/C6H10O2/c1-4-3-6(4,2)5(7)8/h4H,3H2,1-2H3,(H,7,8)/t4?,6-/m1/s1.
What are the key properties of (1R)-1,2-dimethylcyclopropane-1-carboxylic acid?
(1R)-1,2-dimethylcyclopropane-1-carboxylic acid has a molecular weight of 114.14 g/mol, XLogP of 1.12, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-1,2-dimethylcyclopropane-1-carboxylic acid is sourced from PubChem (CID 69400955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).