2-hydroxy-1,3-dimethylcyclopentane-1-carboxylic acid

C8H14O3 — CID 130685696

IUPAC2-hydroxy-1,3-dimethylcyclopentane-1-carboxylic acid
SMILESCC1CCC(C)(C(=O)O)C1O
InChIInChI=1S/C8H14O3/c1-5-3-4-8(2,6(5)9)7(10)11/h5-6,9H,3-4H2,1-2H3,(H,10,11)
InChIKeyDOXNBAWDMGQGGS-UHFFFAOYSA-N
MW158.20 g/mol
LogP0.87
Rot. Bonds1

About 2-hydroxy-1,3-dimethylcyclopentane-1-carboxylic acid

2-hydroxy-1,3-dimethylcyclopentane-1-carboxylic acid (PubChem CID 130685696) has the molecular formula C8H14O3 and a molecular weight of 158.20 g/mol. Its IUPAC name is 2-hydroxy-1,3-dimethylcyclopentane-1-carboxylic acid.

Molecular Properties

Compound Name2-hydroxy-1,3-dimethylcyclopentane-1-carboxylic acid
PubChem CID130685696
Molecular FormulaC8H14O3
Molecular Weight158.20 g/mol
Exact Mass158.09
IUPAC Name2-hydroxy-1,3-dimethylcyclopentane-1-carboxylic acid
SMILESCC1CCC(C)(C(=O)O)C1O
InChIInChI=1S/C8H14O3/c1-5-3-4-8(2,6(5)9)7(10)11/h5-6,9H,3-4H2,1-2H3,(H,10,11)
InChIKeyDOXNBAWDMGQGGS-UHFFFAOYSA-N
XLogP0.87
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500158.20
LogP ≤ 50.87
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-hydroxy-1,3-dimethylcyclopentane-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-hydroxy-1,3-dimethylcyclopentane-1-carboxylic acid?
The IUPAC name of 2-hydroxy-1,3-dimethylcyclopentane-1-carboxylic acid (CID 130685696) is 2-hydroxy-1,3-dimethylcyclopentane-1-carboxylic acid.
What is the SMILES notation for 2-hydroxy-1,3-dimethylcyclopentane-1-carboxylic acid?
The canonical SMILES for 2-hydroxy-1,3-dimethylcyclopentane-1-carboxylic acid is CC1CCC(C)(C(=O)O)C1O.
What is the InChIKey of 2-hydroxy-1,3-dimethylcyclopentane-1-carboxylic acid?
The InChIKey is DOXNBAWDMGQGGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O3/c1-5-3-4-8(2,6(5)9)7(10)11/h5-6,9H,3-4H2,1-2H3,(H,10,11).
What are the key properties of 2-hydroxy-1,3-dimethylcyclopentane-1-carboxylic acid?
2-hydroxy-1,3-dimethylcyclopentane-1-carboxylic acid has a molecular weight of 158.20 g/mol, XLogP of 0.87, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-1,3-dimethylcyclopentane-1-carboxylic acid is sourced from PubChem (CID 130685696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).