C14H24O2 — CID 67990675
1,3-dimethyl-2-(3-methylbut-2-enyl)cyclohexane-1-carboxylic acid (PubChem CID 67990675) has the molecular formula C14H24O2 and a molecular weight of 224.34 g/mol. Its IUPAC name is 1,3-dimethyl-2-(3-methylbut-2-enyl)cyclohexane-1-carboxylic acid.
| Compound Name | 1,3-dimethyl-2-(3-methylbut-2-enyl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 67990675 |
| Molecular Formula | C14H24O2 |
| Molecular Weight | 224.34 g/mol |
| Exact Mass | 224.18 |
| IUPAC Name | 1,3-dimethyl-2-(3-methylbut-2-enyl)cyclohexane-1-carboxylic acid |
| SMILES | CC(C)=CCC1C(C)CCCC1(C)C(=O)O |
| InChI | InChI=1S/C14H24O2/c1-10(2)7-8-12-11(3)6-5-9-14(12,4)13(15)16/h7,11-12H,5-6,8-9H2,1-4H3,(H,15,16) |
| InChIKey | TYSXCPACKAFASK-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.34 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|