C14H24O — CID 142322386
(E)-2-methyl-4-[(1S)-2,2,6-trimethylcyclohexyl]but-2-enal (PubChem CID 142322386) has the molecular formula C14H24O and a molecular weight of 208.35 g/mol. Its IUPAC name is (E)-2-methyl-4-[(1S)-2,2,6-trimethylcyclohexyl]but-2-enal.
| Compound Name | (E)-2-methyl-4-[(1S)-2,2,6-trimethylcyclohexyl]but-2-enal |
|---|---|
| PubChem CID | 142322386 |
| Molecular Formula | C14H24O |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.18 |
| IUPAC Name | (E)-2-methyl-4-[(1S)-2,2,6-trimethylcyclohexyl]but-2-enal |
| SMILES | C/C(C=O)=C\C[C@H]1C(C)CCCC1(C)C |
| InChI | InChI=1S/C14H24O/c1-11(10-15)7-8-13-12(2)6-5-9-14(13,3)4/h7,10,12-13H,5-6,8-9H2,1-4H3/b11-7+/t12?,13-/m0/s1 |
| InChIKey | XKIXDIAVSFQRIZ-QIGDZFGJSA-N |
| XLogP | 3.98 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|