About 2-methyl-4-(1,2,2-trimethylcyclopentyl)but-2-enal
2-methyl-4-(1,2,2-trimethylcyclopentyl)but-2-enal (PubChem CID 140878858) has the molecular formula C13H22O
and a molecular weight of 194.32 g/mol. Its IUPAC name is 2-methyl-4-(1,2,2-trimethylcyclopentyl)but-2-enal.
Molecular Properties
| Compound Name | 2-methyl-4-(1,2,2-trimethylcyclopentyl)but-2-enal |
| PubChem CID | 140878858 |
| Molecular Formula | C13H22O |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.17 |
| IUPAC Name | 2-methyl-4-(1,2,2-trimethylcyclopentyl)but-2-enal |
| SMILES | CC(C=O)=CCC1(C)CCCC1(C)C |
| InChI | InChI=1S/C13H22O/c1-11(10-14)6-9-13(4)8-5-7-12(13,2)3/h6,10H,5,7-9H2,1-4H3 |
| InChIKey | UERTXKXYDXSDEA-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-4-(1,2,2-trimethylcyclopentyl)but-2-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-4-(1,2,2-trimethylcyclopentyl)but-2-enal?
The IUPAC name of 2-methyl-4-(1,2,2-trimethylcyclopentyl)but-2-enal (CID 140878858) is 2-methyl-4-(1,2,2-trimethylcyclopentyl)but-2-enal.
What is the SMILES notation for 2-methyl-4-(1,2,2-trimethylcyclopentyl)but-2-enal?
The canonical SMILES for 2-methyl-4-(1,2,2-trimethylcyclopentyl)but-2-enal is CC(C=O)=CCC1(C)CCCC1(C)C.
What is the InChIKey of 2-methyl-4-(1,2,2-trimethylcyclopentyl)but-2-enal?
The InChIKey is UERTXKXYDXSDEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22O/c1-11(10-14)6-9-13(4)8-5-7-12(13,2)3/h6,10H,5,7-9H2,1-4H3.
What are the key properties of 2-methyl-4-(1,2,2-trimethylcyclopentyl)but-2-enal?
2-methyl-4-(1,2,2-trimethylcyclopentyl)but-2-enal has a molecular weight of 194.32 g/mol, XLogP of 3.74, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4-(1,2,2-trimethylcyclopentyl)but-2-enal is sourced from PubChem (CID 140878858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).