2-(2-hydroxy-1,2-dimethylcyclopentyl)acetic acid

C9H16O3 — CID 130647860

IUPAC2-(2-hydroxy-1,2-dimethylcyclopentyl)acetic acid
SMILESCC1(O)CCCC1(C)CC(=O)O
InChIInChI=1S/C9H16O3/c1-8(6-7(10)11)4-3-5-9(8,2)12/h12H,3-6H2,1-2H3,(H,10,11)
InChIKeyKRCNHCIKUXFYAQ-UHFFFAOYSA-N
MW172.22 g/mol
LogP1.40
Rot. Bonds2

About 2-(2-hydroxy-1,2-dimethylcyclopentyl)acetic acid

2-(2-hydroxy-1,2-dimethylcyclopentyl)acetic acid (PubChem CID 130647860) has the molecular formula C9H16O3 and a molecular weight of 172.22 g/mol. Its IUPAC name is 2-(2-hydroxy-1,2-dimethylcyclopentyl)acetic acid.

Molecular Properties

Compound Name2-(2-hydroxy-1,2-dimethylcyclopentyl)acetic acid
PubChem CID130647860
Molecular FormulaC9H16O3
Molecular Weight172.22 g/mol
Exact Mass172.11
IUPAC Name2-(2-hydroxy-1,2-dimethylcyclopentyl)acetic acid
SMILESCC1(O)CCCC1(C)CC(=O)O
InChIInChI=1S/C9H16O3/c1-8(6-7(10)11)4-3-5-9(8,2)12/h12H,3-6H2,1-2H3,(H,10,11)
InChIKeyKRCNHCIKUXFYAQ-UHFFFAOYSA-N
XLogP1.40
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500172.22
LogP ≤ 51.40
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-(2-hydroxy-1,2-dimethylcyclopentyl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2-hydroxy-1,2-dimethylcyclopentyl)acetic acid?
The IUPAC name of 2-(2-hydroxy-1,2-dimethylcyclopentyl)acetic acid (CID 130647860) is 2-(2-hydroxy-1,2-dimethylcyclopentyl)acetic acid.
What is the SMILES notation for 2-(2-hydroxy-1,2-dimethylcyclopentyl)acetic acid?
The canonical SMILES for 2-(2-hydroxy-1,2-dimethylcyclopentyl)acetic acid is CC1(O)CCCC1(C)CC(=O)O.
What is the InChIKey of 2-(2-hydroxy-1,2-dimethylcyclopentyl)acetic acid?
The InChIKey is KRCNHCIKUXFYAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O3/c1-8(6-7(10)11)4-3-5-9(8,2)12/h12H,3-6H2,1-2H3,(H,10,11).
What are the key properties of 2-(2-hydroxy-1,2-dimethylcyclopentyl)acetic acid?
2-(2-hydroxy-1,2-dimethylcyclopentyl)acetic acid has a molecular weight of 172.22 g/mol, XLogP of 1.40, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-hydroxy-1,2-dimethylcyclopentyl)acetic acid is sourced from PubChem (CID 130647860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).