C7H12O2S — CID 129363672
2-[(2S)-2-methylthiolan-2-yl]acetic acid (PubChem CID 129363672) has the molecular formula C7H12O2S and a molecular weight of 160.24 g/mol. Its IUPAC name is 2-[(2S)-2-methylthiolan-2-yl]acetic acid.
| Compound Name | 2-[(2S)-2-methylthiolan-2-yl]acetic acid |
|---|---|
| PubChem CID | 129363672 |
| Molecular Formula | C7H12O2S |
| Molecular Weight | 160.24 g/mol |
| Exact Mass | 160.06 |
| IUPAC Name | 2-[(2S)-2-methylthiolan-2-yl]acetic acid |
| SMILES | C[C@@]1(CC(=O)O)CCCS1 |
| InChI | InChI=1S/C7H12O2S/c1-7(5-6(8)9)3-2-4-10-7/h2-5H2,1H3,(H,8,9)/t7-/m0/s1 |
| InChIKey | SAAOGNSLESCZGT-ZETCQYMHSA-N |
| XLogP | 1.75 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.24 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |