C10H17NOS — CID 80528490
N-[(2-methylthiolan-2-yl)methyl]cyclopropanecarboxamide (PubChem CID 80528490) has the molecular formula C10H17NOS and a molecular weight of 199.32 g/mol. Its IUPAC name is N-[(2-methylthiolan-2-yl)methyl]cyclopropanecarboxamide.
| Compound Name | N-[(2-methylthiolan-2-yl)methyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 80528490 |
| Molecular Formula | C10H17NOS |
| Molecular Weight | 199.32 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | N-[(2-methylthiolan-2-yl)methyl]cyclopropanecarboxamide |
| SMILES | CC1(CNC(=O)C2CC2)CCCS1 |
| InChI | InChI=1S/C10H17NOS/c1-10(5-2-6-13-10)7-11-9(12)8-3-4-8/h8H,2-7H2,1H3,(H,11,12) |
| InChIKey | IVBVREAVPFZPGT-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.32 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |