C13H23NO2S — CID 96541183
(2S)-2-(cyclopropylmethoxy)-N-[[(2S)-2-methylthiolan-2-yl]methyl]propanamide (PubChem CID 96541183) has the molecular formula C13H23NO2S and a molecular weight of 257.40 g/mol. Its IUPAC name is (2S)-2-(cyclopropylmethoxy)-N-[[(2S)-2-methylthiolan-2-yl]methyl]propanamide.
| Compound Name | (2S)-2-(cyclopropylmethoxy)-N-[[(2S)-2-methylthiolan-2-yl]methyl]propanamide |
|---|---|
| PubChem CID | 96541183 |
| Molecular Formula | C13H23NO2S |
| Molecular Weight | 257.40 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | (2S)-2-(cyclopropylmethoxy)-N-[[(2S)-2-methylthiolan-2-yl]methyl]propanamide |
| SMILES | C[C@H](OCC1CC1)C(=O)NC[C@]1(C)CCCS1 |
| InChI | InChI=1S/C13H23NO2S/c1-10(16-8-11-4-5-11)12(15)14-9-13(2)6-3-7-17-13/h10-11H,3-9H2,1-2H3,(H,14,15)/t10-,13-/m0/s1 |
| InChIKey | MXDXEAIHHYVUMT-GWCFXTLKSA-N |
| XLogP | 2.20 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.40 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |