C8H15NO2S — CID 115694296
methyl N-[(2-methylthiolan-2-yl)methyl]carbamate (PubChem CID 115694296) has the molecular formula C8H15NO2S and a molecular weight of 189.28 g/mol. Its IUPAC name is methyl N-[(2-methylthiolan-2-yl)methyl]carbamate.
| Compound Name | methyl N-[(2-methylthiolan-2-yl)methyl]carbamate |
|---|---|
| PubChem CID | 115694296 |
| Molecular Formula | C8H15NO2S |
| Molecular Weight | 189.28 g/mol |
| Exact Mass | 189.08 |
| IUPAC Name | methyl N-[(2-methylthiolan-2-yl)methyl]carbamate |
| SMILES | COC(=O)NCC1(C)CCCS1 |
| InChI | InChI=1S/C8H15NO2S/c1-8(4-3-5-12-8)6-9-7(10)11-2/h3-6H2,1-2H3,(H,9,10) |
| InChIKey | ZVRWBCRGCGPJPT-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.28 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |