C12H20N2O3S — CID 81167261
1-[(2-methylthiolan-2-yl)methylcarbamoylamino]cyclobutane-1-carboxylic acid (PubChem CID 81167261) has the molecular formula C12H20N2O3S and a molecular weight of 272.37 g/mol. Its IUPAC name is 1-[(2-methylthiolan-2-yl)methylcarbamoylamino]cyclobutane-1-carboxylic acid.
| Compound Name | 1-[(2-methylthiolan-2-yl)methylcarbamoylamino]cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 81167261 |
| Molecular Formula | C12H20N2O3S |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 1-[(2-methylthiolan-2-yl)methylcarbamoylamino]cyclobutane-1-carboxylic acid |
| SMILES | CC1(CNC(=O)NC2(C(=O)O)CCC2)CCCS1 |
| InChI | InChI=1S/C12H20N2O3S/c1-11(4-3-7-18-11)8-13-10(17)14-12(9(15)16)5-2-6-12/h2-8H2,1H3,(H,15,16)(H2,13,14,17) |
| InChIKey | DSYAHRBZHRDHEK-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |