2-(1,2-dimethyl-6-oxabicyclo[3.1.0]hexan-2-yl)acetic acid

C9H14O3 — CID 167313981

IUPAC2-(1,2-dimethyl-6-oxabicyclo[3.1.0]hexan-2-yl)acetic acid
SMILESCC1(CC(=O)O)CCC2OC21C
InChIInChI=1S/C9H14O3/c1-8(5-7(10)11)4-3-6-9(8,2)12-6/h6H,3-5H2,1-2H3,(H,10,11)
InChIKeySWBFPXOOYHVZMW-UHFFFAOYSA-N
MW170.21 g/mol
LogP1.42
Rot. Bonds2

About 2-(1,2-dimethyl-6-oxabicyclo[3.1.0]hexan-2-yl)acetic acid

2-(1,2-dimethyl-6-oxabicyclo[3.1.0]hexan-2-yl)acetic acid (PubChem CID 167313981) has the molecular formula C9H14O3 and a molecular weight of 170.21 g/mol. Its IUPAC name is 2-(1,2-dimethyl-6-oxabicyclo[3.1.0]hexan-2-yl)acetic acid.

Molecular Properties

Compound Name2-(1,2-dimethyl-6-oxabicyclo[3.1.0]hexan-2-yl)acetic acid
PubChem CID167313981
Molecular FormulaC9H14O3
Molecular Weight170.21 g/mol
Exact Mass170.09
IUPAC Name2-(1,2-dimethyl-6-oxabicyclo[3.1.0]hexan-2-yl)acetic acid
SMILESCC1(CC(=O)O)CCC2OC21C
InChIInChI=1S/C9H14O3/c1-8(5-7(10)11)4-3-6-9(8,2)12-6/h6H,3-5H2,1-2H3,(H,10,11)
InChIKeySWBFPXOOYHVZMW-UHFFFAOYSA-N
XLogP1.42
TPSA49.83 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500170.21
LogP ≤ 51.42
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}

Analyze 2-(1,2-dimethyl-6-oxabicyclo[3.1.0]hexan-2-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(1,2-dimethyl-6-oxabicyclo[3.1.0]hexan-2-yl)acetic acid?
The IUPAC name of 2-(1,2-dimethyl-6-oxabicyclo[3.1.0]hexan-2-yl)acetic acid (CID 167313981) is 2-(1,2-dimethyl-6-oxabicyclo[3.1.0]hexan-2-yl)acetic acid.
What is the SMILES notation for 2-(1,2-dimethyl-6-oxabicyclo[3.1.0]hexan-2-yl)acetic acid?
The canonical SMILES for 2-(1,2-dimethyl-6-oxabicyclo[3.1.0]hexan-2-yl)acetic acid is CC1(CC(=O)O)CCC2OC21C.
What is the InChIKey of 2-(1,2-dimethyl-6-oxabicyclo[3.1.0]hexan-2-yl)acetic acid?
The InChIKey is SWBFPXOOYHVZMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O3/c1-8(5-7(10)11)4-3-6-9(8,2)12-6/h6H,3-5H2,1-2H3,(H,10,11).
What are the key properties of 2-(1,2-dimethyl-6-oxabicyclo[3.1.0]hexan-2-yl)acetic acid?
2-(1,2-dimethyl-6-oxabicyclo[3.1.0]hexan-2-yl)acetic acid has a molecular weight of 170.21 g/mol, XLogP of 1.42, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,2-dimethyl-6-oxabicyclo[3.1.0]hexan-2-yl)acetic acid is sourced from PubChem (CID 167313981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).