C8H12O2 — CID 11990949
(1R,2R,5R)-2-ethenyl-1-methyl-6-oxabicyclo[3.1.0]hexan-2-ol (PubChem CID 11990949) has the molecular formula C8H12O2 and a molecular weight of 140.18 g/mol. Its IUPAC name is (1R,2R,5R)-2-ethenyl-1-methyl-6-oxabicyclo[3.1.0]hexan-2-ol.
| Compound Name | (1R,2R,5R)-2-ethenyl-1-methyl-6-oxabicyclo[3.1.0]hexan-2-ol |
|---|---|
| PubChem CID | 11990949 |
| Molecular Formula | C8H12O2 |
| Molecular Weight | 140.18 g/mol |
| Exact Mass | 140.08 |
| IUPAC Name | (1R,2R,5R)-2-ethenyl-1-methyl-6-oxabicyclo[3.1.0]hexan-2-ol |
| SMILES | C=C[C@]1(O)CC[C@H]2O[C@]21C |
| InChI | InChI=1S/C8H12O2/c1-3-8(9)5-4-6-7(8,2)10-6/h3,6,9H,1,4-5H2,2H3/t6-,7-,8+/m1/s1 |
| InChIKey | SQHOZGVLIWOVCJ-PRJMDXOYSA-N |
| XLogP | 0.85 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.18 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|