C10H18O2 — CID 162923110
(2R)-2-[(2S,5S)-5-ethenyl-5-methyloxolan-2-yl]propan-1-ol (PubChem CID 162923110) has the molecular formula C10H18O2 and a molecular weight of 170.25 g/mol. Its IUPAC name is (2R)-2-[(2S,5S)-5-ethenyl-5-methyloxolan-2-yl]propan-1-ol.
| Compound Name | (2R)-2-[(2S,5S)-5-ethenyl-5-methyloxolan-2-yl]propan-1-ol |
|---|---|
| PubChem CID | 162923110 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | (2R)-2-[(2S,5S)-5-ethenyl-5-methyloxolan-2-yl]propan-1-ol |
| SMILES | C=C[C@]1(C)CC[C@@H]([C@H](C)CO)O1 |
| InChI | InChI=1S/C10H18O2/c1-4-10(3)6-5-9(12-10)8(2)7-11/h4,8-9,11H,1,5-7H2,2-3H3/t8-,9+,10-/m1/s1 |
| InChIKey | VUEGXHXUMOZKKN-KXUCPTDWSA-N |
| XLogP | 1.74 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|