C14H22O3 — CID 11961349
(2S,5S)-5-ethenyl-2-methyl-2-[(2R,5S)-5-methyl-5-[(2R)-oxiran-2-yl]oxolan-2-yl]oxolane (PubChem CID 11961349) has the molecular formula C14H22O3 and a molecular weight of 238.33 g/mol. Its IUPAC name is (2S,5S)-5-ethenyl-2-methyl-2-[(2R,5S)-5-methyl-5-[(2R)-oxiran-2-yl]oxolan-2-yl]oxolane.
| Compound Name | (2S,5S)-5-ethenyl-2-methyl-2-[(2R,5S)-5-methyl-5-[(2R)-oxiran-2-yl]oxolan-2-yl]oxolane |
|---|---|
| PubChem CID | 11961349 |
| Molecular Formula | C14H22O3 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.16 |
| IUPAC Name | (2S,5S)-5-ethenyl-2-methyl-2-[(2R,5S)-5-methyl-5-[(2R)-oxiran-2-yl]oxolan-2-yl]oxolane |
| SMILES | C=C[C@@H]1CC[C@@](C)([C@H]2CC[C@@](C)([C@H]3CO3)O2)O1 |
| InChI | InChI=1S/C14H22O3/c1-4-10-5-7-13(2,16-10)11-6-8-14(3,17-11)12-9-15-12/h4,10-12H,1,5-9H2,2-3H3/t10-,11-,12-,13+,14+/m1/s1 |
| InChIKey | PQAKPTYSGJIBEQ-POQQGIQPSA-N |
| XLogP | 2.45 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|