C30H44O8 — CID 20704349
(1R,4S,6R,10E,14R,16R,19R,21S,25E,29R)-4,10,14,19,25,29-hexamethyl-5,8,15,20,23,30-hexaoxapentacyclo[27.1.0.04,6.014,16.019,21]triaconta-10,25-diene-9,24-dione (PubChem CID 20704349) has the molecular formula C30H44O8 and a molecular weight of 532.67 g/mol. Its IUPAC name is (1R,4S,6R,10E,14R,16R,19R,21S,25E,29R)-4,10,14,19,25,29-hexamethyl-5,8,15,20,23,30-hexaoxapentacyclo[27.1.0.04,6.014,16.019,21]triaconta-10,25-diene-9,24-dione.
| Compound Name | (1R,4S,6R,10E,14R,16R,19R,21S,25E,29R)-4,10,14,19,25,29-hexamethyl-5,8,15,20,23,30-hexaoxapentacyclo[27.1.0.04,6.014,16.019,21]triaconta-10,25-diene-9,24-dione |
|---|---|
| PubChem CID | 20704349 |
| Molecular Formula | C30H44O8 |
| Molecular Weight | 532.67 g/mol |
| Exact Mass | 532.30 |
| IUPAC Name | (1R,4S,6R,10E,14R,16R,19R,21S,25E,29R)-4,10,14,19,25,29-hexamethyl-5,8,15,20,23,30-hexaoxapentacyclo[27.1.0.04,6.014,16.019,21]triaconta-10,25-diene-9,24-dione |
| SMILES | C/C1=C\CC[C@@]2(C)O[C@@H]2CC[C@]2(C)O[C@@H]2COC(=O)/C(C)=C/CC[C@@]2(C)O[C@@H]2CC[C@@]2(C)O[C@H]2COC1=O |
| InChI | InChI=1S/C30H44O8/c1-19-9-7-13-27(3)21(35-27)11-16-30(6)24(38-30)18-34-26(32)20(2)10-8-14-28(4)22(36-28)12-15-29(5)23(37-29)17-33-25(19)31/h9-10,21-24H,7-8,11-18H2,1-6H3/b19-9+,20-10+/t21-,22-,23-,24+,27-,28-,29+,30-/m1/s1 |
| InChIKey | AGOBXGFRWKEJKS-ZHOODZDWSA-N |
| XLogP | 4.73 |
| TPSA | 102.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.67 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|