C20H28O8 — CID 10386046
(1S,4R,6S,10S,12S,15R,17S,21S)-1,6,12,17-tetramethyl-5,8,11,16,19,22-hexaoxapentacyclo[19.1.0.04,6.010,12.015,17]docosane-7,18-dione (PubChem CID 10386046) has the molecular formula C20H28O8 and a molecular weight of 396.44 g/mol. Its IUPAC name is (1S,4R,6S,10S,12S,15R,17S,21S)-1,6,12,17-tetramethyl-5,8,11,16,19,22-hexaoxapentacyclo[19.1.0.04,6.010,12.015,17]docosane-7,18-dione.
| Compound Name | (1S,4R,6S,10S,12S,15R,17S,21S)-1,6,12,17-tetramethyl-5,8,11,16,19,22-hexaoxapentacyclo[19.1.0.04,6.010,12.015,17]docosane-7,18-dione |
|---|---|
| PubChem CID | 10386046 |
| Molecular Formula | C20H28O8 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | (1S,4R,6S,10S,12S,15R,17S,21S)-1,6,12,17-tetramethyl-5,8,11,16,19,22-hexaoxapentacyclo[19.1.0.04,6.010,12.015,17]docosane-7,18-dione |
| SMILES | C[C@]12CC[C@H]3O[C@]3(C)C(=O)OC[C@@H]3O[C@@]3(C)CC[C@H]3O[C@]3(C)C(=O)OC[C@@H]1O2 |
| InChI | InChI=1S/C20H28O8/c1-17-7-5-11-19(3,27-11)16(22)24-10-14-18(2,26-14)8-6-12-20(4,28-12)15(21)23-9-13(17)25-17/h11-14H,5-10H2,1-4H3/t11-,12-,13+,14+,17+,18+,19+,20+/m1/s1 |
| InChIKey | UFFRLUZRNPCYMP-ZYRLMNHGSA-N |
| XLogP | 1.28 |
| TPSA | 102.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|