C11H16O3 — CID 121222556
8,8-dimethyl-1a,2,3,4,4a,5-hexahydrooxireno[2,3-e]isochromen-7-one (PubChem CID 121222556) has the molecular formula C11H16O3 and a molecular weight of 196.25 g/mol. Its IUPAC name is 8,8-dimethyl-1a,2,3,4,4a,5-hexahydrooxireno[2,3-e]isochromen-7-one.
| Compound Name | 8,8-dimethyl-1a,2,3,4,4a,5-hexahydrooxireno[2,3-e]isochromen-7-one |
|---|---|
| PubChem CID | 121222556 |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | 8,8-dimethyl-1a,2,3,4,4a,5-hexahydrooxireno[2,3-e]isochromen-7-one |
| SMILES | CC1(C)C(=O)OCC2CCCC3OC231 |
| InChI | InChI=1S/C11H16O3/c1-10(2)9(12)13-6-7-4-3-5-8-11(7,10)14-8/h7-8H,3-6H2,1-2H3 |
| InChIKey | LAFLCJMAUSELMK-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|