C8H14O2Si — CID 102139775
(1S,5R)-1-trimethylsilyl-3-oxabicyclo[3.1.0]hexan-2-one (PubChem CID 102139775) has the molecular formula C8H14O2Si and a molecular weight of 170.28 g/mol. Its IUPAC name is (1S,5R)-1-trimethylsilyl-3-oxabicyclo[3.1.0]hexan-2-one.
| Compound Name | (1S,5R)-1-trimethylsilyl-3-oxabicyclo[3.1.0]hexan-2-one |
|---|---|
| PubChem CID | 102139775 |
| Molecular Formula | C8H14O2Si |
| Molecular Weight | 170.28 g/mol |
| Exact Mass | 170.08 |
| IUPAC Name | (1S,5R)-1-trimethylsilyl-3-oxabicyclo[3.1.0]hexan-2-one |
| SMILES | C[Si](C)(C)[C@@]12C[C@@H]1COC2=O |
| InChI | InChI=1S/C8H14O2Si/c1-11(2,3)8-4-6(8)5-10-7(8)9/h6H,4-5H2,1-3H3/t6-,8+/m1/s1 |
| InChIKey | URHKCIJHLNXVLQ-SVRRBLITSA-N |
| XLogP | 1.64 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.28 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|