C10H15BrO2 — CID 6559228
(1S,5R,8S)-8-(bromomethyl)-1,8-dimethyl-3-oxabicyclo[3.2.1]octan-2-one (PubChem CID 6559228) has the molecular formula C10H15BrO2 and a molecular weight of 247.13 g/mol. Its IUPAC name is (1S,5R,8S)-8-(bromomethyl)-1,8-dimethyl-3-oxabicyclo[3.2.1]octan-2-one.
| Compound Name | (1S,5R,8S)-8-(bromomethyl)-1,8-dimethyl-3-oxabicyclo[3.2.1]octan-2-one |
|---|---|
| PubChem CID | 6559228 |
| Molecular Formula | C10H15BrO2 |
| Molecular Weight | 247.13 g/mol |
| Exact Mass | 246.03 |
| IUPAC Name | (1S,5R,8S)-8-(bromomethyl)-1,8-dimethyl-3-oxabicyclo[3.2.1]octan-2-one |
| SMILES | C[C@]1(CBr)[C@H]2CC[C@]1(C)C(=O)OC2 |
| InChI | InChI=1S/C10H15BrO2/c1-9-4-3-7(5-13-8(9)12)10(9,2)6-11/h7H,3-6H2,1-2H3/t7-,9+,10-/m0/s1 |
| InChIKey | VCKREIFDNRPOLS-SFGNSQDASA-N |
| XLogP | 2.36 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.13 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|