C14H16O2 — CID 58954920
(3aR,7aS)-7a-phenyl-3,3a,4,5,6,7-hexahydro-2-benzofuran-1-one (PubChem CID 58954920) has the molecular formula C14H16O2 and a molecular weight of 216.28 g/mol. Its IUPAC name is (3aR,7aS)-7a-phenyl-3,3a,4,5,6,7-hexahydro-2-benzofuran-1-one.
| Compound Name | (3aR,7aS)-7a-phenyl-3,3a,4,5,6,7-hexahydro-2-benzofuran-1-one |
|---|---|
| PubChem CID | 58954920 |
| Molecular Formula | C14H16O2 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.12 |
| IUPAC Name | (3aR,7aS)-7a-phenyl-3,3a,4,5,6,7-hexahydro-2-benzofuran-1-one |
| SMILES | O=C1OC[C@@H]2CCCC[C@]12c1ccccc1 |
| InChI | InChI=1S/C14H16O2/c15-13-14(11-6-2-1-3-7-11)9-5-4-8-12(14)10-16-13/h1-3,6-7,12H,4-5,8-10H2/t12-,14+/m0/s1 |
| InChIKey | PDLDXOXJUWPJAN-GXTWGEPZSA-N |
| XLogP | 2.67 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |