C11H10OS — CID 102004018
(1R,5S)-1-phenyl-3-oxabicyclo[3.1.0]hexane-2-thione (PubChem CID 102004018) has the molecular formula C11H10OS and a molecular weight of 190.27 g/mol. Its IUPAC name is (1R,5S)-1-phenyl-3-oxabicyclo[3.1.0]hexane-2-thione.
| Compound Name | (1R,5S)-1-phenyl-3-oxabicyclo[3.1.0]hexane-2-thione |
|---|---|
| PubChem CID | 102004018 |
| Molecular Formula | C11H10OS |
| Molecular Weight | 190.27 g/mol |
| Exact Mass | 190.05 |
| IUPAC Name | (1R,5S)-1-phenyl-3-oxabicyclo[3.1.0]hexane-2-thione |
| SMILES | S=C1OC[C@H]2C[C@@]12c1ccccc1 |
| InChI | InChI=1S/C11H10OS/c13-10-11(6-9(11)7-12-10)8-4-2-1-3-5-8/h1-5,9H,6-7H2/t9-,11+/m1/s1 |
| InChIKey | KERABVIPMOHGFG-KOLCDFICSA-N |
| XLogP | 2.30 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.27 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|