C12H13NO3S — CID 125489294
(1R,5R)-3-methylsulfonyl-1-phenyl-3-azabicyclo[3.1.0]hexan-2-one (PubChem CID 125489294) has the molecular formula C12H13NO3S and a molecular weight of 251.31 g/mol. Its IUPAC name is (1R,5R)-3-methylsulfonyl-1-phenyl-3-azabicyclo[3.1.0]hexan-2-one.
| Compound Name | (1R,5R)-3-methylsulfonyl-1-phenyl-3-azabicyclo[3.1.0]hexan-2-one |
|---|---|
| PubChem CID | 125489294 |
| Molecular Formula | C12H13NO3S |
| Molecular Weight | 251.31 g/mol |
| Exact Mass | 251.06 |
| IUPAC Name | (1R,5R)-3-methylsulfonyl-1-phenyl-3-azabicyclo[3.1.0]hexan-2-one |
| SMILES | CS(=O)(=O)N1C[C@@H]2C[C@@]2(c2ccccc2)C1=O |
| InChI | InChI=1S/C12H13NO3S/c1-17(15,16)13-8-10-7-12(10,11(13)14)9-5-3-2-4-6-9/h2-6,10H,7-8H2,1H3/t10-,12-/m0/s1 |
| InChIKey | BUPASWXEAUYHCB-JQWIXIFHSA-N |
| XLogP | 0.75 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.31 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |