C10H13NO3S — CID 95051819
(2R)-2-methyl-4-methylsulfonyl-2,3-dihydro-1,4-benzoxazine (PubChem CID 95051819) has the molecular formula C10H13NO3S and a molecular weight of 227.28 g/mol. Its IUPAC name is (2R)-2-methyl-4-methylsulfonyl-2,3-dihydro-1,4-benzoxazine.
| Compound Name | (2R)-2-methyl-4-methylsulfonyl-2,3-dihydro-1,4-benzoxazine |
|---|---|
| PubChem CID | 95051819 |
| Molecular Formula | C10H13NO3S |
| Molecular Weight | 227.28 g/mol |
| Exact Mass | 227.06 |
| IUPAC Name | (2R)-2-methyl-4-methylsulfonyl-2,3-dihydro-1,4-benzoxazine |
| SMILES | C[C@@H]1CN(S(C)(=O)=O)c2ccccc2O1 |
| InChI | InChI=1S/C10H13NO3S/c1-8-7-11(15(2,12)13)9-5-3-4-6-10(9)14-8/h3-6,8H,7H2,1-2H3/t8-/m1/s1 |
| InChIKey | JOYUBAQZGHBCDP-MRVPVSSYSA-N |
| XLogP | 1.23 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.28 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |