C17H21NO7S2 — CID 88501926
4-methylbenzenesulfonic acid;(4-methylsulfonyl-2,3-dihydro-1,4-benzoxazin-2-yl)methanol (PubChem CID 88501926) has the molecular formula C17H21NO7S2 and a molecular weight of 415.49 g/mol. Its IUPAC name is 4-methylbenzenesulfonic acid;(4-methylsulfonyl-2,3-dihydro-1,4-benzoxazin-2-yl)methanol.
| Compound Name | 4-methylbenzenesulfonic acid;(4-methylsulfonyl-2,3-dihydro-1,4-benzoxazin-2-yl)methanol |
|---|---|
| PubChem CID | 88501926 |
| Molecular Formula | C17H21NO7S2 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.08 |
| IUPAC Name | 4-methylbenzenesulfonic acid;(4-methylsulfonyl-2,3-dihydro-1,4-benzoxazin-2-yl)methanol |
| SMILES | CS(=O)(=O)N1CC(CO)Oc2ccccc21.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C10H13NO4S.C7H8O3S/c1-16(13,14)11-6-8(7-12)15-10-5-3-2-4-9(10)11;1-6-2-4-7(5-3-6)11(8,9)10/h2-5,8,12H,6-7H2,1H3;2-5H,1H3,(H,8,9,10) |
| InChIKey | NGBQXSDWQQQACJ-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 121.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|