C23H23NO6S — CID 19788088
5-(hydroxymethyl)-3-(4-phenylphenyl)-1,3-oxazolidin-2-one;4-methylbenzenesulfonic acid (PubChem CID 19788088) has the molecular formula C23H23NO6S and a molecular weight of 441.51 g/mol. Its IUPAC name is 5-(hydroxymethyl)-3-(4-phenylphenyl)-1,3-oxazolidin-2-one;4-methylbenzenesulfonic acid.
| Compound Name | 5-(hydroxymethyl)-3-(4-phenylphenyl)-1,3-oxazolidin-2-one;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 19788088 |
| Molecular Formula | C23H23NO6S |
| Molecular Weight | 441.51 g/mol |
| Exact Mass | 441.12 |
| IUPAC Name | 5-(hydroxymethyl)-3-(4-phenylphenyl)-1,3-oxazolidin-2-one;4-methylbenzenesulfonic acid |
| SMILES | Cc1ccc(S(=O)(=O)O)cc1.O=C1OC(CO)CN1c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C16H15NO3.C7H8O3S/c18-11-15-10-17(16(19)20-15)14-8-6-13(7-9-14)12-4-2-1-3-5-12;1-6-2-4-7(5-3-6)11(8,9)10/h1-9,15,18H,10-11H2;2-5H,1H3,(H,8,9,10) |
| InChIKey | FFMLSFKJPDBELZ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.51 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|