C19H19IN2O5 — CID 70208277
(5R)-5-(hydroxymethyl)-3-(4-iodophenyl)-1,3-oxazolidin-2-one;3-phenyl-1,3-oxazolidin-2-one (PubChem CID 70208277) has the molecular formula C19H19IN2O5 and a molecular weight of 482.27 g/mol. Its IUPAC name is (5R)-5-(hydroxymethyl)-3-(4-iodophenyl)-1,3-oxazolidin-2-one;3-phenyl-1,3-oxazolidin-2-one.
| Compound Name | (5R)-5-(hydroxymethyl)-3-(4-iodophenyl)-1,3-oxazolidin-2-one;3-phenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 70208277 |
| Molecular Formula | C19H19IN2O5 |
| Molecular Weight | 482.27 g/mol |
| Exact Mass | 482.03 |
| IUPAC Name | (5R)-5-(hydroxymethyl)-3-(4-iodophenyl)-1,3-oxazolidin-2-one;3-phenyl-1,3-oxazolidin-2-one |
| SMILES | O=C1OCCN1c1ccccc1.O=C1O[C@@H](CO)CN1c1ccc(I)cc1 |
| InChI | InChI=1S/C10H10INO3.C9H9NO2/c11-7-1-3-8(4-2-7)12-5-9(6-13)15-10(12)14;11-9-10(6-7-12-9)8-4-2-1-3-5-8/h1-4,9,13H,5-6H2;1-5H,6-7H2/t9-;/m1./s1 |
| InChIKey | HRQWRMJLVNDPDA-SBSPUUFOSA-N |
| XLogP | 3.25 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.27 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|