C10H10ClNO2 — CID 11310370
(5R)-5-(chloromethyl)-3-phenyl-1,3-oxazolidin-2-one (PubChem CID 11310370) has the molecular formula C10H10ClNO2 and a molecular weight of 211.65 g/mol. Its IUPAC name is (5R)-5-(chloromethyl)-3-phenyl-1,3-oxazolidin-2-one.
| Compound Name | (5R)-5-(chloromethyl)-3-phenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 11310370 |
| Molecular Formula | C10H10ClNO2 |
| Molecular Weight | 211.65 g/mol |
| Exact Mass | 211.04 |
| IUPAC Name | (5R)-5-(chloromethyl)-3-phenyl-1,3-oxazolidin-2-one |
| SMILES | O=C1O[C@@H](CCl)CN1c1ccccc1 |
| InChI | InChI=1S/C10H10ClNO2/c11-6-9-7-12(10(13)14-9)8-4-2-1-3-5-8/h1-5,9H,6-7H2/t9-/m0/s1 |
| InChIKey | KARLWXPEKSFFJC-VIFPVBQESA-N |
| XLogP | 2.25 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.65 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|