C17H17NO3 — CID 124582958
(5S)-3-phenyl-5-(phenylmethoxymethyl)-1,3-oxazolidin-2-one (PubChem CID 124582958) has the molecular formula C17H17NO3 and a molecular weight of 283.33 g/mol. Its IUPAC name is (5S)-3-phenyl-5-(phenylmethoxymethyl)-1,3-oxazolidin-2-one.
| Compound Name | (5S)-3-phenyl-5-(phenylmethoxymethyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 124582958 |
| Molecular Formula | C17H17NO3 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | (5S)-3-phenyl-5-(phenylmethoxymethyl)-1,3-oxazolidin-2-one |
| SMILES | O=C1O[C@H](COCc2ccccc2)CN1c1ccccc1 |
| InChI | InChI=1S/C17H17NO3/c19-17-18(15-9-5-2-6-10-15)11-16(21-17)13-20-12-14-7-3-1-4-8-14/h1-10,16H,11-13H2/t16-/m0/s1 |
| InChIKey | MLDTYQAUWYDELH-INIZCTEOSA-N |
| XLogP | 3.23 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |