C10H10FNO2 — CID 555364
5-(fluoromethyl)-3-phenyl-1,3-oxazolidin-2-one (PubChem CID 555364) has the molecular formula C10H10FNO2 and a molecular weight of 195.19 g/mol. Its IUPAC name is 5-(fluoromethyl)-3-phenyl-1,3-oxazolidin-2-one.
| Compound Name | 5-(fluoromethyl)-3-phenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 555364 |
| Molecular Formula | C10H10FNO2 |
| Molecular Weight | 195.19 g/mol |
| Exact Mass | 195.07 |
| IUPAC Name | 5-(fluoromethyl)-3-phenyl-1,3-oxazolidin-2-one |
| SMILES | O=C1OC(CF)CN1c1ccccc1 |
| InChI | InChI=1S/C10H10FNO2/c11-6-9-7-12(10(13)14-9)8-4-2-1-3-5-8/h1-5,9H,6-7H2 |
| InChIKey | IVMGFKMDJDXTPQ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.19 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |