C12H10ClF4NO2 — CID 102443365
5-(3-chloro-2,2,3,3-tetrafluoropropyl)-3-phenyl-1,3-oxazolidin-2-one (PubChem CID 102443365) has the molecular formula C12H10ClF4NO2 and a molecular weight of 311.66 g/mol. Its IUPAC name is 5-(3-chloro-2,2,3,3-tetrafluoropropyl)-3-phenyl-1,3-oxazolidin-2-one.
| Compound Name | 5-(3-chloro-2,2,3,3-tetrafluoropropyl)-3-phenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 102443365 |
| Molecular Formula | C12H10ClF4NO2 |
| Molecular Weight | 311.66 g/mol |
| Exact Mass | 311.03 |
| IUPAC Name | 5-(3-chloro-2,2,3,3-tetrafluoropropyl)-3-phenyl-1,3-oxazolidin-2-one |
| SMILES | O=C1OC(CC(F)(F)C(F)(F)Cl)CN1c1ccccc1 |
| InChI | InChI=1S/C12H10ClF4NO2/c13-12(16,17)11(14,15)6-9-7-18(10(19)20-9)8-4-2-1-3-5-8/h1-5,9H,6-7H2 |
| InChIKey | KFKCJDKCGAXMEL-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.66 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|