About 5-[(2-oxo-1,3-oxazolidin-3-yl)methyl]-3-phenyl-1,3-oxazolidin-2-one
5-[(2-oxo-1,3-oxazolidin-3-yl)methyl]-3-phenyl-1,3-oxazolidin-2-one (PubChem CID 117063703) has the molecular formula C13H14N2O4
and a molecular weight of 262.26 g/mol. Its IUPAC name is 5-[(2-oxo-1,3-oxazolidin-3-yl)methyl]-3-phenyl-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | 5-[(2-oxo-1,3-oxazolidin-3-yl)methyl]-3-phenyl-1,3-oxazolidin-2-one |
| PubChem CID | 117063703 |
| Molecular Formula | C13H14N2O4 |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | 5-[(2-oxo-1,3-oxazolidin-3-yl)methyl]-3-phenyl-1,3-oxazolidin-2-one |
| SMILES | O=C1OCCN1CC1CN(c2ccccc2)C(=O)O1 |
| InChI | InChI=1S/C13H14N2O4/c16-12-14(6-7-18-12)8-11-9-15(13(17)19-11)10-4-2-1-3-5-10/h1-5,11H,6-9H2 |
| InChIKey | CIXQYVCZPGXWRM-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[(2-oxo-1,3-oxazolidin-3-yl)methyl]-3-phenyl-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2-oxo-1,3-oxazolidin-3-yl)methyl]-3-phenyl-1,3-oxazolidin-2-one?
The IUPAC name of 5-[(2-oxo-1,3-oxazolidin-3-yl)methyl]-3-phenyl-1,3-oxazolidin-2-one (CID 117063703) is 5-[(2-oxo-1,3-oxazolidin-3-yl)methyl]-3-phenyl-1,3-oxazolidin-2-one.
What is the SMILES notation for 5-[(2-oxo-1,3-oxazolidin-3-yl)methyl]-3-phenyl-1,3-oxazolidin-2-one?
The canonical SMILES for 5-[(2-oxo-1,3-oxazolidin-3-yl)methyl]-3-phenyl-1,3-oxazolidin-2-one is O=C1OCCN1CC1CN(c2ccccc2)C(=O)O1.
What is the InChIKey of 5-[(2-oxo-1,3-oxazolidin-3-yl)methyl]-3-phenyl-1,3-oxazolidin-2-one?
The InChIKey is CIXQYVCZPGXWRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N2O4/c16-12-14(6-7-18-12)8-11-9-15(13(17)19-11)10-4-2-1-3-5-10/h1-5,11H,6-9H2.
What are the key properties of 5-[(2-oxo-1,3-oxazolidin-3-yl)methyl]-3-phenyl-1,3-oxazolidin-2-one?
5-[(2-oxo-1,3-oxazolidin-3-yl)methyl]-3-phenyl-1,3-oxazolidin-2-one has a molecular weight of 262.26 g/mol, XLogP of 1.46, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2-oxo-1,3-oxazolidin-3-yl)methyl]-3-phenyl-1,3-oxazolidin-2-one is sourced from PubChem (CID 117063703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).