C11H14N2O2 — CID 15117126
5-(2-aminoethyl)-3-phenyl-1,3-oxazolidin-2-one (PubChem CID 15117126) has the molecular formula C11H14N2O2 and a molecular weight of 206.25 g/mol. Its IUPAC name is 5-(2-aminoethyl)-3-phenyl-1,3-oxazolidin-2-one.
| Compound Name | 5-(2-aminoethyl)-3-phenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 15117126 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 5-(2-aminoethyl)-3-phenyl-1,3-oxazolidin-2-one |
| SMILES | NCCC1CN(c2ccccc2)C(=O)O1 |
| InChI | InChI=1S/C11H14N2O2/c12-7-6-10-8-13(11(14)15-10)9-4-2-1-3-5-9/h1-5,10H,6-8,12H2 |
| InChIKey | GRDXFLAHTNSCMX-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |