C12H15FN2O2 — CID 115060000
5-(3-aminopropyl)-3-(4-fluorophenyl)-1,3-oxazolidin-2-one (PubChem CID 115060000) has the molecular formula C12H15FN2O2 and a molecular weight of 238.26 g/mol. Its IUPAC name is 5-(3-aminopropyl)-3-(4-fluorophenyl)-1,3-oxazolidin-2-one.
| Compound Name | 5-(3-aminopropyl)-3-(4-fluorophenyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 115060000 |
| Molecular Formula | C12H15FN2O2 |
| Molecular Weight | 238.26 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 5-(3-aminopropyl)-3-(4-fluorophenyl)-1,3-oxazolidin-2-one |
| SMILES | NCCCC1CN(c2ccc(F)cc2)C(=O)O1 |
| InChI | InChI=1S/C12H15FN2O2/c13-9-3-5-10(6-4-9)15-8-11(2-1-7-14)17-12(15)16/h3-6,11H,1-2,7-8,14H2 |
| InChIKey | QIAWHOHVLDXHEJ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.26 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |