C13H16FNO3 — CID 143755381
3-(4-fluorophenyl)-6-(3-hydroxypropyl)-1,3-oxazinan-2-one (PubChem CID 143755381) has the molecular formula C13H16FNO3 and a molecular weight of 253.27 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-6-(3-hydroxypropyl)-1,3-oxazinan-2-one.
| Compound Name | 3-(4-fluorophenyl)-6-(3-hydroxypropyl)-1,3-oxazinan-2-one |
|---|---|
| PubChem CID | 143755381 |
| Molecular Formula | C13H16FNO3 |
| Molecular Weight | 253.27 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 3-(4-fluorophenyl)-6-(3-hydroxypropyl)-1,3-oxazinan-2-one |
| SMILES | O=C1OC(CCCO)CCN1c1ccc(F)cc1 |
| InChI | InChI=1S/C13H16FNO3/c14-10-3-5-11(6-4-10)15-8-7-12(2-1-9-16)18-13(15)17/h3-6,12,16H,1-2,7-9H2 |
| InChIKey | QVSLVICHSHMOGA-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.27 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |