C10H8Cl3NO2 — CID 107654588
5-(chloromethyl)-3-(3,5-dichlorophenyl)-1,3-oxazolidin-2-one (PubChem CID 107654588) has the molecular formula C10H8Cl3NO2 and a molecular weight of 280.54 g/mol. Its IUPAC name is 5-(chloromethyl)-3-(3,5-dichlorophenyl)-1,3-oxazolidin-2-one.
| Compound Name | 5-(chloromethyl)-3-(3,5-dichlorophenyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 107654588 |
| Molecular Formula | C10H8Cl3NO2 |
| Molecular Weight | 280.54 g/mol |
| Exact Mass | 278.96 |
| IUPAC Name | 5-(chloromethyl)-3-(3,5-dichlorophenyl)-1,3-oxazolidin-2-one |
| SMILES | O=C1OC(CCl)CN1c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C10H8Cl3NO2/c11-4-9-5-14(10(15)16-9)8-2-6(12)1-7(13)3-8/h1-3,9H,4-5H2 |
| InChIKey | UNBLHWIJBCXZSB-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.54 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|