C15H11F2IN2O2 — CID 10432033
3-(3,5-difluoro-4-pyridin-4-ylphenyl)-5-(iodomethyl)-1,3-oxazolidin-2-one (PubChem CID 10432033) has the molecular formula C15H11F2IN2O2 and a molecular weight of 416.17 g/mol. Its IUPAC name is 3-(3,5-difluoro-4-pyridin-4-ylphenyl)-5-(iodomethyl)-1,3-oxazolidin-2-one.
| Compound Name | 3-(3,5-difluoro-4-pyridin-4-ylphenyl)-5-(iodomethyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 10432033 |
| Molecular Formula | C15H11F2IN2O2 |
| Molecular Weight | 416.17 g/mol |
| Exact Mass | 415.98 |
| IUPAC Name | 3-(3,5-difluoro-4-pyridin-4-ylphenyl)-5-(iodomethyl)-1,3-oxazolidin-2-one |
| SMILES | O=C1OC(CI)CN1c1cc(F)c(-c2ccncc2)c(F)c1 |
| InChI | InChI=1S/C15H11F2IN2O2/c16-12-5-10(20-8-11(7-18)22-15(20)21)6-13(17)14(12)9-1-3-19-4-2-9/h1-6,11H,7-8H2 |
| InChIKey | WBKGSESTAKGYID-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.17 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|