C10H7BrF2INO2 — CID 118050988
(5R)-3-(4-bromo-2,6-difluorophenyl)-5-(iodomethyl)-1,3-oxazolidin-2-one (PubChem CID 118050988) has the molecular formula C10H7BrF2INO2 and a molecular weight of 417.98 g/mol. Its IUPAC name is (5R)-3-(4-bromo-2,6-difluorophenyl)-5-(iodomethyl)-1,3-oxazolidin-2-one.
| Compound Name | (5R)-3-(4-bromo-2,6-difluorophenyl)-5-(iodomethyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 118050988 |
| Molecular Formula | C10H7BrF2INO2 |
| Molecular Weight | 417.98 g/mol |
| Exact Mass | 416.87 |
| IUPAC Name | (5R)-3-(4-bromo-2,6-difluorophenyl)-5-(iodomethyl)-1,3-oxazolidin-2-one |
| SMILES | O=C1O[C@@H](CI)CN1c1c(F)cc(Br)cc1F |
| InChI | InChI=1S/C10H7BrF2INO2/c11-5-1-7(12)9(8(13)2-5)15-4-6(3-14)17-10(15)16/h1-2,6H,3-4H2/t6-/m0/s1 |
| InChIKey | QLCALKYSAPVJMU-LURJTMIESA-N |
| XLogP | 3.49 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.98 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|