C14H17F2N3O4S — CID 68878196
(5R)-5-(aminomethyl)-3-[4-(1,1-dioxo-1,4-thiazinan-4-yl)-3,5-difluorophenyl]-1,3-oxazolidin-2-one (PubChem CID 68878196) has the molecular formula C14H17F2N3O4S and a molecular weight of 361.37 g/mol. Its IUPAC name is (5R)-5-(aminomethyl)-3-[4-(1,1-dioxo-1,4-thiazinan-4-yl)-3,5-difluorophenyl]-1,3-oxazolidin-2-one.
| Compound Name | (5R)-5-(aminomethyl)-3-[4-(1,1-dioxo-1,4-thiazinan-4-yl)-3,5-difluorophenyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 68878196 |
| Molecular Formula | C14H17F2N3O4S |
| Molecular Weight | 361.37 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | (5R)-5-(aminomethyl)-3-[4-(1,1-dioxo-1,4-thiazinan-4-yl)-3,5-difluorophenyl]-1,3-oxazolidin-2-one |
| SMILES | NC[C@@H]1CN(c2cc(F)c(N3CCS(=O)(=O)CC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C14H17F2N3O4S/c15-11-5-9(19-8-10(7-17)23-14(19)20)6-12(16)13(11)18-1-3-24(21,22)4-2-18/h5-6,10H,1-4,7-8,17H2/t10-/m1/s1 |
| InChIKey | LVLIJASGBOHAMG-SNVBAGLBSA-N |
| XLogP | 0.48 |
| TPSA | 92.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.37 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|