C15H17F2N3O5S — CID 11625257
3-[4-(1,1-dioxo-1,4-thiazepan-4-yl)-3,5-difluorophenyl]-2-oxo-1,3-oxazolidine-5-carboxamide (PubChem CID 11625257) has the molecular formula C15H17F2N3O5S and a molecular weight of 389.38 g/mol. Its IUPAC name is 3-[4-(1,1-dioxo-1,4-thiazepan-4-yl)-3,5-difluorophenyl]-2-oxo-1,3-oxazolidine-5-carboxamide.
| Compound Name | 3-[4-(1,1-dioxo-1,4-thiazepan-4-yl)-3,5-difluorophenyl]-2-oxo-1,3-oxazolidine-5-carboxamide |
|---|---|
| PubChem CID | 11625257 |
| Molecular Formula | C15H17F2N3O5S |
| Molecular Weight | 389.38 g/mol |
| Exact Mass | 389.09 |
| IUPAC Name | 3-[4-(1,1-dioxo-1,4-thiazepan-4-yl)-3,5-difluorophenyl]-2-oxo-1,3-oxazolidine-5-carboxamide |
| SMILES | NC(=O)C1CN(c2cc(F)c(N3CCCS(=O)(=O)CC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C15H17F2N3O5S/c16-10-6-9(20-8-12(14(18)21)25-15(20)22)7-11(17)13(10)19-2-1-4-26(23,24)5-3-19/h6-7,12H,1-5,8H2,(H2,18,21) |
| InChIKey | OZSXRHGIFHBWJA-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 110.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.38 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|