C15H17F2N3O4 — CID 10215354
(5R)-3-(3,5-difluoro-4-morpholin-4-ylphenyl)-N-methyl-2-oxo-1,3-oxazolidine-5-carboxamide (PubChem CID 10215354) has the molecular formula C15H17F2N3O4 and a molecular weight of 341.31 g/mol. Its IUPAC name is (5R)-3-(3,5-difluoro-4-morpholin-4-ylphenyl)-N-methyl-2-oxo-1,3-oxazolidine-5-carboxamide.
| Compound Name | (5R)-3-(3,5-difluoro-4-morpholin-4-ylphenyl)-N-methyl-2-oxo-1,3-oxazolidine-5-carboxamide |
|---|---|
| PubChem CID | 10215354 |
| Molecular Formula | C15H17F2N3O4 |
| Molecular Weight | 341.31 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | (5R)-3-(3,5-difluoro-4-morpholin-4-ylphenyl)-N-methyl-2-oxo-1,3-oxazolidine-5-carboxamide |
| SMILES | CNC(=O)[C@H]1CN(c2cc(F)c(N3CCOCC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C15H17F2N3O4/c1-18-14(21)12-8-20(15(22)24-12)9-6-10(16)13(11(17)7-9)19-2-4-23-5-3-19/h6-7,12H,2-5,8H2,1H3,(H,18,21)/t12-/m1/s1 |
| InChIKey | CJPBTUBBXNYPCV-GFCCVEGCSA-N |
| XLogP | 0.87 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.31 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|