C17H17FN4O3 — CID 87470731
(5R)-3-[4-(1-cyano-3,6-dihydro-2H-pyridin-4-yl)-3-fluorophenyl]-N-methyl-2-oxo-1,3-oxazolidine-5-carboxamide (PubChem CID 87470731) has the molecular formula C17H17FN4O3 and a molecular weight of 344.35 g/mol. Its IUPAC name is (5R)-3-[4-(1-cyano-3,6-dihydro-2H-pyridin-4-yl)-3-fluorophenyl]-N-methyl-2-oxo-1,3-oxazolidine-5-carboxamide.
| Compound Name | (5R)-3-[4-(1-cyano-3,6-dihydro-2H-pyridin-4-yl)-3-fluorophenyl]-N-methyl-2-oxo-1,3-oxazolidine-5-carboxamide |
|---|---|
| PubChem CID | 87470731 |
| Molecular Formula | C17H17FN4O3 |
| Molecular Weight | 344.35 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | (5R)-3-[4-(1-cyano-3,6-dihydro-2H-pyridin-4-yl)-3-fluorophenyl]-N-methyl-2-oxo-1,3-oxazolidine-5-carboxamide |
| SMILES | CNC(=O)[C@H]1CN(c2ccc(C3=CCN(C#N)CC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C17H17FN4O3/c1-20-16(23)15-9-22(17(24)25-15)12-2-3-13(14(18)8-12)11-4-6-21(10-19)7-5-11/h2-4,8,15H,5-7,9H2,1H3,(H,20,23)/t15-/m1/s1 |
| InChIKey | CQYRLLAZDHCCEA-OAHLLOKOSA-N |
| XLogP | 1.47 |
| TPSA | 85.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.35 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|