C16H19F2N3O5S — CID 166925763
[3-[3,5-difluoro-4-(1-oxo-1,4-thiazinan-4-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl N-methylcarbamate (PubChem CID 166925763) has the molecular formula C16H19F2N3O5S and a molecular weight of 403.41 g/mol. Its IUPAC name is [3-[3,5-difluoro-4-(1-oxo-1,4-thiazinan-4-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl N-methylcarbamate.
| Compound Name | [3-[3,5-difluoro-4-(1-oxo-1,4-thiazinan-4-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl N-methylcarbamate |
|---|---|
| PubChem CID | 166925763 |
| Molecular Formula | C16H19F2N3O5S |
| Molecular Weight | 403.41 g/mol |
| Exact Mass | 403.10 |
| IUPAC Name | [3-[3,5-difluoro-4-(1-oxo-1,4-thiazinan-4-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl N-methylcarbamate |
| SMILES | CNC(=O)OCC1CN(c2cc(F)c(N3CCS(=O)CC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C16H19F2N3O5S/c1-19-15(22)25-9-11-8-21(16(23)26-11)10-6-12(17)14(13(18)7-10)20-2-4-27(24)5-3-20/h6-7,11H,2-5,8-9H2,1H3,(H,19,22) |
| InChIKey | SLVYTGLONVPPOC-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.41 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|