C16H20F2N2O6S — CID 72659431
[3-[3,5-difluoro-4-(4-hydroxypiperidin-1-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl methanesulfonate (PubChem CID 72659431) has the molecular formula C16H20F2N2O6S and a molecular weight of 406.41 g/mol. Its IUPAC name is [3-[3,5-difluoro-4-(4-hydroxypiperidin-1-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl methanesulfonate.
| Compound Name | [3-[3,5-difluoro-4-(4-hydroxypiperidin-1-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 72659431 |
| Molecular Formula | C16H20F2N2O6S |
| Molecular Weight | 406.41 g/mol |
| Exact Mass | 406.10 |
| IUPAC Name | [3-[3,5-difluoro-4-(4-hydroxypiperidin-1-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl methanesulfonate |
| SMILES | CS(=O)(=O)OCC1CN(c2cc(F)c(N3CCC(O)CC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C16H20F2N2O6S/c1-27(23,24)25-9-12-8-20(16(22)26-12)10-6-13(17)15(14(18)7-10)19-4-2-11(21)3-5-19/h6-7,11-12,21H,2-5,8-9H2,1H3 |
| InChIKey | XZQMKKLUVOBPRN-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.41 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|