C16H18FNO6S — CID 90700530
[(5R)-3-[4-(3,6-dihydro-2H-pyran-2-yl)-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl methanesulfonate (PubChem CID 90700530) has the molecular formula C16H18FNO6S and a molecular weight of 371.39 g/mol. Its IUPAC name is [(5R)-3-[4-(3,6-dihydro-2H-pyran-2-yl)-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl methanesulfonate.
| Compound Name | [(5R)-3-[4-(3,6-dihydro-2H-pyran-2-yl)-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 90700530 |
| Molecular Formula | C16H18FNO6S |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.08 |
| IUPAC Name | [(5R)-3-[4-(3,6-dihydro-2H-pyran-2-yl)-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl methanesulfonate |
| SMILES | CS(=O)(=O)OC[C@H]1CN(c2ccc(C3CC=CCO3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C16H18FNO6S/c1-25(20,21)23-10-12-9-18(16(19)24-12)11-5-6-13(14(17)8-11)15-4-2-3-7-22-15/h2-3,5-6,8,12,15H,4,7,9-10H2,1H3/t12-,15?/m1/s1 |
| InChIKey | HUCCWYVXLFQANO-KEKZHRQWSA-N |
| XLogP | 2.14 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|