C13H16FNO5S — CID 87281379
2-[3-(3-fluoro-4-methylphenyl)-2-oxo-1,3-oxazolidin-5-yl]ethyl methanesulfonate (PubChem CID 87281379) has the molecular formula C13H16FNO5S and a molecular weight of 317.34 g/mol. Its IUPAC name is 2-[3-(3-fluoro-4-methylphenyl)-2-oxo-1,3-oxazolidin-5-yl]ethyl methanesulfonate.
| Compound Name | 2-[3-(3-fluoro-4-methylphenyl)-2-oxo-1,3-oxazolidin-5-yl]ethyl methanesulfonate |
|---|---|
| PubChem CID | 87281379 |
| Molecular Formula | C13H16FNO5S |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | 2-[3-(3-fluoro-4-methylphenyl)-2-oxo-1,3-oxazolidin-5-yl]ethyl methanesulfonate |
| SMILES | Cc1ccc(N2CC(CCOS(C)(=O)=O)OC2=O)cc1F |
| InChI | InChI=1S/C13H16FNO5S/c1-9-3-4-10(7-12(9)14)15-8-11(20-13(15)16)5-6-19-21(2,17)18/h3-4,7,11H,5-6,8H2,1-2H3 |
| InChIKey | XHWSEHZWYGEDGU-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|