C19H22FN3O7S — CID 59754049
2-[1-[2-fluoro-4-[(5R)-5-(methylsulfonyloxymethyl)-2-oxo-1,3-oxazolidin-3-yl]phenyl]piperidin-4-yl]-2-isocyanoacetic acid (PubChem CID 59754049) has the molecular formula C19H22FN3O7S and a molecular weight of 455.46 g/mol. Its IUPAC name is 2-[1-[2-fluoro-4-[(5R)-5-(methylsulfonyloxymethyl)-2-oxo-1,3-oxazolidin-3-yl]phenyl]piperidin-4-yl]-2-isocyanoacetic acid.
| Compound Name | 2-[1-[2-fluoro-4-[(5R)-5-(methylsulfonyloxymethyl)-2-oxo-1,3-oxazolidin-3-yl]phenyl]piperidin-4-yl]-2-isocyanoacetic acid |
|---|---|
| PubChem CID | 59754049 |
| Molecular Formula | C19H22FN3O7S |
| Molecular Weight | 455.46 g/mol |
| Exact Mass | 455.12 |
| IUPAC Name | 2-[1-[2-fluoro-4-[(5R)-5-(methylsulfonyloxymethyl)-2-oxo-1,3-oxazolidin-3-yl]phenyl]piperidin-4-yl]-2-isocyanoacetic acid |
| SMILES | [C-]#[N+]C(C(=O)O)C1CCN(c2ccc(N3C[C@H](COS(C)(=O)=O)OC3=O)cc2F)CC1 |
| InChI | InChI=1S/C19H22FN3O7S/c1-21-17(18(24)25)12-5-7-22(8-6-12)16-4-3-13(9-15(16)20)23-10-14(30-19(23)26)11-29-31(2,27)28/h3-4,9,12,14,17H,5-8,10-11H2,2H3,(H,24,25)/t14-,17?/m1/s1 |
| InChIKey | RWNQQIYRHZOJCV-XPCCGILXSA-N |
| XLogP | 1.72 |
| TPSA | 117.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.46 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|